Products 2490698-30-9

CAS 2490698-30-9 is the registry number for 4-(4-fluorophenyl)tetrahydro-2H-thiopyran-4-carboxylic acid 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.

4-(4-fluorophenyl)-1,1-dioxothiane-4-carboxylic acid (CAS 2490698-30-9) is a chemical compound with the molecular formula C12H13FO4S and a molecular weight of 272.29 g/mol. IUPAC name: 4-(4-fluorophenyl)-1,1-dioxothiane-4-carboxylic acid. InChIKey: SVYZTSUAPAGBLN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13FO4S
Molecular weight272.29 g/mol
IUPAC name4-(4-fluorophenyl)-1,1-dioxothiane-4-carboxylic acid
InChIKeySVYZTSUAPAGBLN-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CCC1(C2=CC=C(C=C2)F)C(=O)O

Computed by PubChem (NCBI)