CAS 1673-44-5 appears in our catalog under these names: 5-(3-Methoxyphenyl)-1,3,4-oxadiazol-2-amine, 95%, 5-(3-Methoxyphenyl)-1,3,4-oxadiazol-2-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g, 5g.
5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-amine (CAS 1673-44-5) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-amine. InChIKey: FUZRSOHZLMZNAX-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | FUZRSOHZLMZNAX-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=NN=C(O2)N |
Computed by PubChem (NCBI)