CAS 167478-82-2 appears in our catalog under these names: Methyl 1,5-dimethyl-1H-indole-2-carboxylate, Methyl 1,5-dimethyl-1h-indole-2-carboxylate, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 500mg, 1000mg, 2000mg, 5000mg, 250mg, 1g.
Methyl 1,5-dimethylindole-2-carboxylate (CAS 167478-82-2) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: methyl 1,5-dimethylindole-2-carboxylate. InChIKey: XCLVWEJWFCVZCT-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | methyl 1,5-dimethylindole-2-carboxylate |
| InChIKey | XCLVWEJWFCVZCT-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C(=C2)C(=O)OC)C |
Computed by PubChem (NCBI)