CAS 1675217-42-1 appears in our catalog under these names: Aminocaproic Acid Impurity 6, Aminocaproic acid Impurity D, Aminocaproic Acid Impurity 7, 2-(2-((5-carboxypentyl)amino)-2-oxoethyl)-2-hydroxybutanedioic Acid. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[2-(5-carboxypentylamino)-2-oxoethyl]-2-hydroxybutanedioic acid (CAS 1675217-42-1) is a chemical compound with the molecular formula C12H19NO8 and a molecular weight of 305.28 g/mol. IUPAC name: 2-[2-(5-carboxypentylamino)-2-oxoethyl]-2-hydroxybutanedioic acid. InChIKey: RBTFEUGRKODLQB-UHFFFAOYSA-N.
| Molecular formula | C12H19NO8 |
|---|---|
| Molecular weight | 305.28 g/mol |
| IUPAC name | 2-[2-(5-carboxypentylamino)-2-oxoethyl]-2-hydroxybutanedioic acid |
| InChIKey | RBTFEUGRKODLQB-UHFFFAOYSA-N |
| SMILES | C(CCC(=O)O)CCNC(=O)CC(CC(=O)O)(C(=O)O)O |
Computed by PubChem (NCBI)