Products 25875-99-4
CAS 25875-99-4 appears in our catalog under these names: N-Acetyl-2,3-dehydro-2-deoxyneuraminic acid methyl ester, 95%, N-Acetyl-2,3-dehydro-2-deoxyneuraminic acid methyl ester. Offered by: Combi-blocks, Biosynth, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, 1000mg, 2000mg, 50 mg, 5 mg, 10 mg.
Methyl (2R,3R,4S)-3-acetamido-4-hydroxy-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate (CAS 25875-99-4) is a chemical compound with the molecular formula C12H19NO8 and a molecular weight of 305.28 g/mol. IUPAC name: methyl (2R,3R,4S)-3-acetamido-4-hydroxy-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate. InChIKey: SPILYXOSOLBQAQ-CNYIRLTGSA-N.
| Molecular formula | C12H19NO8 |
|---|---|
| Molecular weight | 305.28 g/mol |
| IUPAC name | methyl (2R,3R,4S)-3-acetamido-4-hydroxy-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| InChIKey | SPILYXOSOLBQAQ-CNYIRLTGSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H](C=C(O[C@H]1[C@@H]([C@@H](CO)O)O)C(=O)OC)O |
Computed by PubChem (NCBI)