CAS 477775-77-2 appears in our catalog under these names: N-Hydroxysuccinimide MeO-Peg3 carbonate, 95%, m–PEG3–succinimidyl carbonate, N-Hydroxysuccinimide MeO-Peg3 carbonate, 95%, 95%, m-PEG3-succinimidyl carbonate, 95.0%, 2,5-Pyrrolidinedione, 1-[(1-oxo-2,5,8,11-tetraoxadodec-1-yl)oxy]-, 95%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 100 mg, 250 mg, 1 g.
(2,5-dioxopyrrolidin-1-yl) 2-[2-(2-methoxyethoxy)ethoxy]ethyl carbonate (CAS 477775-77-2) is a chemical compound with the molecular formula C12H19NO8 and a molecular weight of 305.28 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-[2-(2-methoxyethoxy)ethoxy]ethyl carbonate. InChIKey: JCUAHGNZBWSEIM-UHFFFAOYSA-N.
| Molecular formula | C12H19NO8 |
|---|---|
| Molecular weight | 305.28 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-[2-(2-methoxyethoxy)ethoxy]ethyl carbonate |
| InChIKey | JCUAHGNZBWSEIM-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)