Products 16757-63-4

CAS 16757-63-4 is the registry number for 2-Amino-3-(1H-pyrazol-5-yl)propanoic acid, 95.0%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-amino-3-(1H-pyrazol-5-yl)propanoic acid (CAS 16757-63-4) is a chemical compound with the molecular formula C6H9N3O2 and a molecular weight of 155.15 g/mol. IUPAC name: 2-amino-3-(1H-pyrazol-5-yl)propanoic acid. InChIKey: VOWKMMDXKYIBPG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9N3O2
Molecular weight155.15 g/mol
IUPAC name2-amino-3-(1H-pyrazol-5-yl)propanoic acid
InChIKeyVOWKMMDXKYIBPG-UHFFFAOYSA-N
SMILESC1=C(NN=C1)CC(C(=O)O)N

Computed by PubChem (NCBI)