Products 16766-64-6
CAS 16766-64-6 is the registry number for 3-Phenyltetrahydrothiophene 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-phenylthiolane 1,1-dioxide (CAS 16766-64-6) is a chemical compound with the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. IUPAC name: 3-phenylthiolane 1,1-dioxide. InChIKey: LKPQZMTWAPOZMV-UHFFFAOYSA-N.
| Molecular formula | C10H12O2S |
|---|---|
| Molecular weight | 196.27 g/mol |
| IUPAC name | 3-phenylthiolane 1,1-dioxide |
| InChIKey | LKPQZMTWAPOZMV-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
3-Phenyltetrahydrothiophene 1,1-dioxide, 3-phenylthiolane 1,1-dioxide, 3-phenylsulfolane, 3-phenylthiolane-1,1-dione, 3-Phenylthiolane,S,S-dioxide, LKPQZMTWAPOZMV-UHFFFAOYSA-N, 3-Phenyl-1lambda~6~-thiolane-1,1-dione, 3-Phenyltetrahydrothiophene 1,1-dioxide #, 1-oxo-3-phenyl-1lambda-tetrahydro-1H-thiophen-1-ium-1-olate