Products 1781856-45-8

CAS 1781856-45-8 is the registry number for 5-Bromo-6-oxo-1,6-dihydropyridazine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-bromo-6-oxo-1H-pyridazine-3-carboxylic acid (CAS 1781856-45-8) is a chemical compound with the molecular formula C5H3BrN2O3 and a molecular weight of 218.99 g/mol. IUPAC name: 5-bromo-6-oxo-1H-pyridazine-3-carboxylic acid. InChIKey: ZJLYNKYASUMCBW-UHFFFAOYSA-N.

Identity
Molecular formulaC5H3BrN2O3
Molecular weight218.99 g/mol
IUPAC name5-bromo-6-oxo-1H-pyridazine-3-carboxylic acid
InChIKeyZJLYNKYASUMCBW-UHFFFAOYSA-N
SMILESC1=C(C(=O)NN=C1C(=O)O)Br

Computed by PubChem (NCBI)