CAS 52092-43-0 appears in our catalog under these names: 2–Bromo–4–nitropyridine N–oxide, 2-Bromo-4-nitropyridine N-Oxide, >98.0%(GC), 2-Bromo-4-nitropyridine 1-oxide 98%, 2-Bromo-4-nitropyridine 1-oxide, 98%, 98%, 2-Bromo-4-nitropyridine 1-oxide, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g.
2-bromo-4-nitro-1-oxidopyridin-1-ium (CAS 52092-43-0) is a chemical compound with the molecular formula C5H3BrN2O3 and a molecular weight of 218.99 g/mol. IUPAC name: 2-bromo-4-nitro-1-oxidopyridin-1-ium. InChIKey: IRBDHXCXCSFNEQ-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN2O3 |
|---|---|
| Molecular weight | 218.99 g/mol |
| IUPAC name | 2-bromo-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | IRBDHXCXCSFNEQ-UHFFFAOYSA-N |
| SMILES | C1=C[N+](=C(C=C1[N+](=O)[O-])Br)[O-] |
Computed by PubChem (NCBI)