Products 168155-52-0
CAS 168155-52-0 is the registry number for N-(3-Fluorophenyl)-3-formyl-n-methylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
N-(3-fluorophenyl)-3-formyl-N-methylbenzamide (CAS 168155-52-0) is a chemical compound with the molecular formula C15H12FNO2 and a molecular weight of 257.26 g/mol. IUPAC name: N-(3-fluorophenyl)-3-formyl-N-methylbenzamide. InChIKey: ZBEMVEQFSWCODH-UHFFFAOYSA-N.
| Molecular formula | C15H12FNO2 |
|---|---|
| Molecular weight | 257.26 g/mol |
| IUPAC name | N-(3-fluorophenyl)-3-formyl-N-methylbenzamide |
| InChIKey | ZBEMVEQFSWCODH-UHFFFAOYSA-N |
| SMILES | CN(C1=CC(=CC=C1)F)C(=O)C2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)