Products 2837261-92-2
CAS 2837261-92-2 is the registry number for (S)-2-Fluoro-6-(4-phenyl-4,5-dihydrooxazol-2-yl)phenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-6-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)phenol (CAS 2837261-92-2) is a chemical compound with the molecular formula C15H12FNO2 and a molecular weight of 257.26 g/mol. IUPAC name: 2-fluoro-6-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)phenol. InChIKey: ABGOIHQVDWWYMW-UHFFFAOYSA-N.
| Molecular formula | C15H12FNO2 |
|---|---|
| Molecular weight | 257.26 g/mol |
| IUPAC name | 2-fluoro-6-(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)phenol |
| InChIKey | ABGOIHQVDWWYMW-UHFFFAOYSA-N |
| SMILES | C1C(N=C(O1)C2=C(C(=CC=C2)F)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)