CAS 312703-73-4 appears in our catalog under these names: N-(4-Acetylphenyl)-3-fluorobenzamide, 95%, N-(4-Acetylphenyl)-3-fluorobenzamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
N-(4-acetylphenyl)-3-fluorobenzamide (CAS 312703-73-4) is a chemical compound with the molecular formula C15H12FNO2 and a molecular weight of 257.26 g/mol. IUPAC name: N-(4-acetylphenyl)-3-fluorobenzamide. InChIKey: MMEIEOIONWJJRR-UHFFFAOYSA-N.
| Molecular formula | C15H12FNO2 |
|---|---|
| Molecular weight | 257.26 g/mol |
| IUPAC name | N-(4-acetylphenyl)-3-fluorobenzamide |
| InChIKey | MMEIEOIONWJJRR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)NC(=O)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)