CAS 16835-77-1 appears in our catalog under these names: 3-Deoxy-2-C-(hydroxymethyl)-D-erythro-pentonic acid, calcium salt, 97.00%, Calcium α-D-isosaccharinate. Offered by: Chemat, Biosynth. Available pack sizes: 100mg, 250mg, 500mg, 50mg, 25mg.
Calcium bis((2S,4S)-2,4,5-trihydroxy-2-(hydroxymethyl)pentanoate) (CAS 16835-77-1) is a chemical compound with the molecular formula C12H22CaO12 and a molecular weight of 398.37 g/mol. IUPAC name: calcium bis((2S,4S)-2,4,5-trihydroxy-2-(hydroxymethyl)pentanoate). InChIKey: JDNCPQAABKGYIO-FRCKEXEZSA-L.
| Molecular formula | C12H22CaO12 |
|---|---|
| Molecular weight | 398.37 g/mol |
| IUPAC name | calcium bis((2S,4S)-2,4,5-trihydroxy-2-(hydroxymethyl)pentanoate) |
| InChIKey | JDNCPQAABKGYIO-FRCKEXEZSA-L |
| SMILES | C([C@@H](CO)O)[C@](CO)(C(=O)[O-])O.C([C@@H](CO)O)[C@](CO)(C(=O)[O-])O.[Ca+2] |
Computed by PubChem (NCBI)