Products 84324-95-8
CAS 84324-95-8 appears in our catalog under these names: Calcium ^a-D-isosaccharinate, 98% (Assay) , Calcium ^A-D-isosacCHArinate. Offered by: Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 5g, 25g, 10g.
Calcium bis(2,4,5-trihydroxy-2-(hydroxymethyl)pentanoate) (CAS 84324-95-8) is a chemical compound with the molecular formula C12H22CaO12 and a molecular weight of 398.37 g/mol. IUPAC name: calcium bis(2,4,5-trihydroxy-2-(hydroxymethyl)pentanoate). InChIKey: JDNCPQAABKGYIO-UHFFFAOYSA-L.
| Molecular formula | C12H22CaO12 |
|---|---|
| Molecular weight | 398.37 g/mol |
| IUPAC name | calcium bis(2,4,5-trihydroxy-2-(hydroxymethyl)pentanoate) |
| InChIKey | JDNCPQAABKGYIO-UHFFFAOYSA-L |
| SMILES | C(C(CO)O)C(CO)(C(=O)[O-])O.C(C(CO)O)C(CO)(C(=O)[O-])O.[Ca+2] |
Computed by PubChem (NCBI)