Products 96154-36-8
CAS 96154-36-8 appears in our catalog under these names: 3-Deoxy-D-gluconic acid calcium, 3-Deoxy-D-ribo-hexonic acid, calcium salt, 97.00%. Offered by: Biosynth, Chemat. Available pack sizes: 5mg, 2mg, 10mg, 25mg, 50mg.
Calcium bis((2R,4S,5R)-2,4,5,6-tetrahydroxyhexanoate) (CAS 96154-36-8) is a chemical compound with the molecular formula C12H22CaO12 and a molecular weight of 398.37 g/mol. IUPAC name: calcium bis((2R,4S,5R)-2,4,5,6-tetrahydroxyhexanoate). InChIKey: DVZDAVQCKQBWQK-JKBQDGHKSA-L.
| Molecular formula | C12H22CaO12 |
|---|---|
| Molecular weight | 398.37 g/mol |
| IUPAC name | calcium bis((2R,4S,5R)-2,4,5,6-tetrahydroxyhexanoate) |
| InChIKey | DVZDAVQCKQBWQK-JKBQDGHKSA-L |
| SMILES | C([C@@H]([C@@H](CO)O)O)[C@H](C(=O)[O-])O.C([C@@H]([C@@H](CO)O)O)[C@H](C(=O)[O-])O.[Ca+2] |
Computed by PubChem (NCBI)