CAS 16851-83-5 is the registry number for 1-[(4-Chlorophenyl)sulfonyl]-1H-pyrrole, 97% . Offered by: Thermo Scientific. Available pack sizes: 10g, 25g.
1-(4-chlorophenyl)sulfonylpyrrole (CAS 16851-83-5) is a chemical compound with the molecular formula C10H8ClNO2S and a molecular weight of 241.69 g/mol. IUPAC name: 1-(4-chlorophenyl)sulfonylpyrrole. InChIKey: ACNNPPGRQRFTSO-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2S |
|---|---|
| Molecular weight | 241.69 g/mol |
| IUPAC name | 1-(4-chlorophenyl)sulfonylpyrrole |
| InChIKey | ACNNPPGRQRFTSO-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)S(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)