CAS 168618-35-7 is the registry number for Methyl 3-(pyrazol-1-yl)benzoate, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Methyl 3-pyrazol-1-ylbenzoate (CAS 168618-35-7) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: methyl 3-pyrazol-1-ylbenzoate. InChIKey: FNFWFAVDUMMRJN-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | methyl 3-pyrazol-1-ylbenzoate |
| InChIKey | FNFWFAVDUMMRJN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC=C1)N2C=CC=N2 |
Computed by PubChem (NCBI)