CAS 168638-04-8 appears in our catalog under these names: 5-(2,4,6-Trimethylphenyl)-1,3,4-oxadiazole-2-thiol, 95%, 5-(2,4,6-Trimethylphenyl)-1,3,4-oxadiazole-2-thiol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5-(2,4,6-trimethylphenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 168638-04-8) is a chemical compound with the molecular formula C11H12N2OS and a molecular weight of 220.29 g/mol. IUPAC name: 5-(2,4,6-trimethylphenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: XBPSHAKHRMRFHC-UHFFFAOYSA-N.
| Molecular formula | C11H12N2OS |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | 5-(2,4,6-trimethylphenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | XBPSHAKHRMRFHC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=NNC(=S)O2)C |
Computed by PubChem (NCBI)