CAS 168786-98-9 is the registry number for Methyl-2,3-dideoxy-3-fluoro-5-O-(4-phenylbenzoyl)-a-D-erythro-pentofuranoside. Offered by: Biosynth. Available pack sizes: 1g.
[(2R,3S,5S)-3-fluoro-5-methoxyoxolan-2-yl]methyl 4-phenylbenzoate (CAS 168786-98-9) is a chemical compound with the molecular formula C19H19FO4 and a molecular weight of 330.3 g/mol. IUPAC name: [(2R,3S,5S)-3-fluoro-5-methoxyoxolan-2-yl]methyl 4-phenylbenzoate. InChIKey: GPEUOGREWRRXPI-KSZLIROESA-N.
| Molecular formula | C19H19FO4 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | [(2R,3S,5S)-3-fluoro-5-methoxyoxolan-2-yl]methyl 4-phenylbenzoate |
| InChIKey | GPEUOGREWRRXPI-KSZLIROESA-N |
| SMILES | CO[C@@H]1C[C@@H]([C@H](O1)COC(=O)C2=CC=C(C=C2)C3=CC=CC=C3)F |
Computed by PubChem (NCBI)