CAS 1688669-84-2 appears in our catalog under these names: 3-(4-Cyanophenyl)-2,2-dimethylpropanoic acid, 95%, 3-(4-Cyanophenyl)-2,2-dimethylpropanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(4-cyanophenyl)-2,2-dimethylpropanoic acid (CAS 1688669-84-2) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: 3-(4-cyanophenyl)-2,2-dimethylpropanoic acid. InChIKey: DWZLPQVTESBUBN-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 3-(4-cyanophenyl)-2,2-dimethylpropanoic acid |
| InChIKey | DWZLPQVTESBUBN-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC=C(C=C1)C#N)C(=O)O |
Computed by PubChem (NCBI)