CAS 168903-13-7 is the registry number for 3-Amino-2,3-dihydro-1H-inden-5-ol hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-amino-2,3-dihydro-1H-inden-5-ol;hydrochloride (CAS 168903-13-7) is a chemical compound with the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. IUPAC name: 3-amino-2,3-dihydro-1H-inden-5-ol;hydrochloride. InChIKey: JJLALHYSNFSWQZ-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO |
|---|---|
| Molecular weight | 185.65 g/mol |
| IUPAC name | 3-amino-2,3-dihydro-1H-inden-5-ol;hydrochloride |
| InChIKey | JJLALHYSNFSWQZ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C=C(C=C2)O.Cl |
Computed by PubChem (NCBI)