CAS 169105-03-7 appears in our catalog under these names: (3R)-3-Amino-2,3-dihydro-1h-inden-5-ol hydrochloride, 95%, (3R)-3-Amino-2,3-dihydro-1H-inden-5-ol hydrochloride, (R)-3-Amino-2,3-dihydro-1H-inden-5-ol hydrochloride, 97%, 97%, (3R)-3-amino-2,3-dihydro-1H-inden-5-ol hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 0,25g, 100mg, 500mg.
(3R)-3-amino-2,3-dihydro-1H-inden-5-ol;hydrochloride (CAS 169105-03-7) is a chemical compound with the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. IUPAC name: (3R)-3-amino-2,3-dihydro-1H-inden-5-ol;hydrochloride. InChIKey: JJLALHYSNFSWQZ-SBSPUUFOSA-N.
| Molecular formula | C9H12ClNO |
|---|---|
| Molecular weight | 185.65 g/mol |
| IUPAC name | (3R)-3-amino-2,3-dihydro-1H-inden-5-ol;hydrochloride |
| InChIKey | JJLALHYSNFSWQZ-SBSPUUFOSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=C(C=C2)O.Cl |
Computed by PubChem (NCBI)