CAS 168958-19-8 appears in our catalog under these names: Peramivir Impurity 19, Peramivir Impurity 17, Peramivir Impurity 24. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl (1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-ene-1-carboxylate (CAS 168958-19-8) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: methyl (1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-ene-1-carboxylate. InChIKey: HKLDTKMTZPXEAZ-IUCAKERBSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | methyl (1R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-ene-1-carboxylate |
| InChIKey | HKLDTKMTZPXEAZ-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](C=C1)C(=O)OC |
Computed by PubChem (NCBI)