CAS 229613-91-6 is the registry number for rel-(1R,4S)-Methyl 4-((tert-butoxycarbonyl)amino)cyclopent-2-enecarboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl (1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-ene-1-carboxylate (CAS 229613-91-6) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: methyl (1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-ene-1-carboxylate. InChIKey: HKLDTKMTZPXEAZ-DTWKUNHWSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | methyl (1R,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopent-2-ene-1-carboxylate |
| InChIKey | HKLDTKMTZPXEAZ-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@H](C=C1)C(=O)OC |
Computed by PubChem (NCBI)