Products 1690085-29-0
CAS 1690085-29-0 is the registry number for rac-(3R,4R)-1-{((9H-Fluoren-9-yl)methoxy)carbonyl}-4-methylpyrrolidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3S,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-methylpyrrolidine-3-carboxylic acid (CAS 1690085-29-0) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: (3S,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-methylpyrrolidine-3-carboxylic acid. InChIKey: UZAANVFMPWVILR-FZKQIMNGSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (3S,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-methylpyrrolidine-3-carboxylic acid |
| InChIKey | UZAANVFMPWVILR-FZKQIMNGSA-N |
| SMILES | C[C@@H]1CN(C[C@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)