Products 1690112-93-6
CAS 1690112-93-6 appears in our catalog under these names: cis-1-(2,2-Difluoroethyl)pyrrolidine-3,4-diol, (3R,4S)-1-(2,2-Difluoroethyl)pyrrolidine-3,4-diol, 98%. Offered by: TRC, AmBeed. Available pack sizes: 100mg, 1g, 5g, 250mg.
(3S,4R)-1-(2,2-difluoroethyl)pyrrolidine-3,4-diol (CAS 1690112-93-6) is a chemical compound with the molecular formula C6H11F2NO2 and a molecular weight of 167.15 g/mol. IUPAC name: (3S,4R)-1-(2,2-difluoroethyl)pyrrolidine-3,4-diol. InChIKey: VCHJFTHAYVVEPI-SYDPRGILSA-N.
| Molecular formula | C6H11F2NO2 |
|---|---|
| Molecular weight | 167.15 g/mol |
| IUPAC name | (3S,4R)-1-(2,2-difluoroethyl)pyrrolidine-3,4-diol |
| InChIKey | VCHJFTHAYVVEPI-SYDPRGILSA-N |
| SMILES | C1[C@H]([C@H](CN1CC(F)F)O)O |
Computed by PubChem (NCBI)