CAS 2095886-37-4 is the registry number for (S)-2-Amino-3,3-difluoro-4-methylpentanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-3,3-difluoro-4-methylpentanoic acid (CAS 2095886-37-4) is a chemical compound with the molecular formula C6H11F2NO2 and a molecular weight of 167.15 g/mol. IUPAC name: (2S)-2-amino-3,3-difluoro-4-methylpentanoic acid. InChIKey: XXVSVJMOOGHOQD-BYPYZUCNSA-N.
| Molecular formula | C6H11F2NO2 |
|---|---|
| Molecular weight | 167.15 g/mol |
| IUPAC name | (2S)-2-amino-3,3-difluoro-4-methylpentanoic acid |
| InChIKey | XXVSVJMOOGHOQD-BYPYZUCNSA-N |
| SMILES | CC(C)C([C@H](C(=O)O)N)(F)F |
Computed by PubChem (NCBI)