Products 2660254-93-1
CAS 2660254-93-1 is the registry number for rel-(3R,4R)-5,5-Difluoro-4-methoxypiperidin-3-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4R)-5,5-difluoro-4-methoxypiperidin-3-ol (CAS 2660254-93-1) is a chemical compound with the molecular formula C6H11F2NO2 and a molecular weight of 167.15 g/mol. IUPAC name: (3R,4R)-5,5-difluoro-4-methoxypiperidin-3-ol. InChIKey: FMHBIBQULQPEOX-RFZPGFLSSA-N.
| Molecular formula | C6H11F2NO2 |
|---|---|
| Molecular weight | 167.15 g/mol |
| IUPAC name | (3R,4R)-5,5-difluoro-4-methoxypiperidin-3-ol |
| InChIKey | FMHBIBQULQPEOX-RFZPGFLSSA-N |
| SMILES | CO[C@@H]1[C@@H](CNCC1(F)F)O |
Computed by PubChem (NCBI)