CAS 169032-17-1 is the registry number for Fexofenadine Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(4-chlorobutanoyl)phenyl]-2-methylpropanenitrile (CAS 169032-17-1) is a chemical compound with the molecular formula C14H16ClNO and a molecular weight of 249.73 g/mol. IUPAC name: 2-[4-(4-chlorobutanoyl)phenyl]-2-methylpropanenitrile. InChIKey: DFBINOKKRKAUOD-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNO |
|---|---|
| Molecular weight | 249.73 g/mol |
| IUPAC name | 2-[4-(4-chlorobutanoyl)phenyl]-2-methylpropanenitrile |
| InChIKey | DFBINOKKRKAUOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=CC=C(C=C1)C(=O)CCCCl |
Computed by PubChem (NCBI)