CAS 169040-62-4 appears in our catalog under these names: 4-(3,3-Diethyl-ureido)-benzenesulfonyl chloride, 98%, 4-(3,3-Diethylureido)benzene-1-sulfonyl chloride, 97%. Offered by: Fluorochem, AmBeed. Available pack sizes: 1g.
4-(diethylcarbamoylamino)benzenesulfonyl chloride (CAS 169040-62-4) is a chemical compound with the molecular formula C11H15ClN2O3S and a molecular weight of 290.77 g/mol. IUPAC name: 4-(diethylcarbamoylamino)benzenesulfonyl chloride. InChIKey: RLIMBLHEKHFIGP-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O3S |
|---|---|
| Molecular weight | 290.77 g/mol |
| IUPAC name | 4-(diethylcarbamoylamino)benzenesulfonyl chloride |
| InChIKey | RLIMBLHEKHFIGP-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)NC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)