CAS 923190-13-0 appears in our catalog under these names: N-(2-[4-(Aminosulfonyl)phenyl]ethyl)-2-chloropropanamide, 95%, 2-Chloro-n-[2-(4-sulfamoylphenyl)ethyl]propanamide, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 500mg.
2-chloro-N-[2-(4-sulfamoylphenyl)ethyl]propanamide (CAS 923190-13-0) is a chemical compound with the molecular formula C11H15ClN2O3S and a molecular weight of 290.77 g/mol. IUPAC name: 2-chloro-N-[2-(4-sulfamoylphenyl)ethyl]propanamide. InChIKey: ZSQIFFBKILEOFB-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O3S |
|---|---|
| Molecular weight | 290.77 g/mol |
| IUPAC name | 2-chloro-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
| InChIKey | ZSQIFFBKILEOFB-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NCCC1=CC=C(C=C1)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)