CAS 33375-71-2 is the registry number for (2R)-2-Amino-3-{((phenylformamido)methyl)sulfanyl}propanoic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
(2R)-2-amino-3-(benzamidomethylsulfanyl)propanoic acid;hydrochloride (CAS 33375-71-2) is a chemical compound with the molecular formula C11H15ClN2O3S and a molecular weight of 290.77 g/mol. IUPAC name: (2R)-2-amino-3-(benzamidomethylsulfanyl)propanoic acid;hydrochloride. InChIKey: SFHVEELLGXMKTE-FVGYRXGTSA-N.
| Molecular formula | C11H15ClN2O3S |
|---|---|
| Molecular weight | 290.77 g/mol |
| IUPAC name | (2R)-2-amino-3-(benzamidomethylsulfanyl)propanoic acid;hydrochloride |
| InChIKey | SFHVEELLGXMKTE-FVGYRXGTSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NCSC[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)