Products 1690434-90-2
CAS 1690434-90-2 is the registry number for 2-Amino-5-nitro-4-pyridinecarboxamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-amino-5-nitropyridine-4-carboxamide (CAS 1690434-90-2) is a chemical compound with the molecular formula C6H6N4O3 and a molecular weight of 182.14 g/mol. IUPAC name: 2-amino-5-nitropyridine-4-carboxamide. InChIKey: PIXFMPDJWWBJKR-UHFFFAOYSA-N.
| Molecular formula | C6H6N4O3 |
|---|---|
| Molecular weight | 182.14 g/mol |
| IUPAC name | 2-amino-5-nitropyridine-4-carboxamide |
| InChIKey | PIXFMPDJWWBJKR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1N)[N+](=O)[O-])C(=O)N |
Computed by PubChem (NCBI)