CAS 169045-04-9 appears in our catalog under these names: 2–Amino–5–bromo–4–methoxybenzoic acid, 2-Amino-5-bromo-4-methoxybenzoic acid, 2-Amino-5-bromo-4-methoxybenzoic acid 95%, 2-Amino-5-bromo-4-methoxybenzoic acid, 98%, 98%, 2-Amino-5-bromo-4-methoxybenzoic acid, 96%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100mg, 250mg, 100g.
2-amino-5-bromo-4-methoxybenzoic acid (CAS 169045-04-9) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 2-amino-5-bromo-4-methoxybenzoic acid. InChIKey: YTAASTFSTXYEIX-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 2-amino-5-bromo-4-methoxybenzoic acid |
| InChIKey | YTAASTFSTXYEIX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)N)C(=O)O)Br |
Computed by PubChem (NCBI)