Products 1690948-00-5
CAS 1690948-00-5 is the registry number for 6-{4-((tert-Butoxy)carbonyl)piperazin-1-yl}pyridazine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg.
6-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyridazine-3-carboxylic acid (CAS 1690948-00-5) is a chemical compound with the molecular formula C14H20N4O4 and a molecular weight of 308.33 g/mol. IUPAC name: 6-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyridazine-3-carboxylic acid. InChIKey: OAQLZTZRDMKOML-UHFFFAOYSA-N.
| Molecular formula | C14H20N4O4 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | 6-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyridazine-3-carboxylic acid |
| InChIKey | OAQLZTZRDMKOML-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NN=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)