CAS 169126-64-1 appears in our catalog under these names: (3,5,5,8,8-Pentamethyl-5,6,7,8-tetrahydronaphthalen-2-yl)boronic acid, 95%, 95%, (3,5,5,8,8-Pentamethyl-5,6,7,8-tetrahydronaphthalen-2-yl)boronic acid, 98%, (3,5,5,8,8-Pentamethyl-5,6,7,8-tetrahydronaphthalen-2-yl)boronic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)boronic acid (CAS 169126-64-1) is a chemical compound with the molecular formula C15H23BO2 and a molecular weight of 246.15 g/mol. IUPAC name: (3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)boronic acid. InChIKey: CHQAGZBOYKWZNW-UHFFFAOYSA-N.
| Molecular formula | C15H23BO2 |
|---|---|
| Molecular weight | 246.15 g/mol |
| IUPAC name | (3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)boronic acid |
| InChIKey | CHQAGZBOYKWZNW-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1C)C(CCC2(C)C)(C)C)(O)O |
Computed by PubChem (NCBI)