CAS 169158-05-8 appears in our catalog under these names: (S)-2-((tert-Butoxycarbonyl)amino)-3-(4-ethynylphenyl)propanoic acid, 95%, Boc-L-Phe(4-Eth)-OH, N-BOC-4-ETHYNYL-L-PHENYLALANINE, 97%. Offered by: AmBeed, Iris Biotech, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
(2S)-3-(4-ethynylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 169158-05-8) is a chemical compound with the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. IUPAC name: (2S)-3-(4-ethynylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: HIBKCGJNRUGNKU-ZDUSSCGKSA-N.
| Molecular formula | C16H19NO4 |
|---|---|
| Molecular weight | 289.33 g/mol |
| IUPAC name | (2S)-3-(4-ethynylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | HIBKCGJNRUGNKU-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)C#C)C(=O)O |
Computed by PubChem (NCBI)