Products 1691747-12-2
CAS 1691747-12-2 is the registry number for 1-(4-Aminophenyl)-3-oxocyclobutane-1-carboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 1g.
1-(4-aminophenyl)-3-oxocyclobutane-1-carboxylic acid (CAS 1691747-12-2) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 1-(4-aminophenyl)-3-oxocyclobutane-1-carboxylic acid. InChIKey: OYBYQICDITXZGP-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 1-(4-aminophenyl)-3-oxocyclobutane-1-carboxylic acid |
| InChIKey | OYBYQICDITXZGP-UHFFFAOYSA-N |
| SMILES | C1C(=O)CC1(C2=CC=C(C=C2)N)C(=O)O |
Computed by PubChem (NCBI)