CAS 169189-80-4 appears in our catalog under these names: 2-Bromo-N-ethylbenzenesulfonamide, 98%, 2-Bromo-N-ethylbenzenesulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g.
2-bromo-N-ethylbenzenesulfonamide (CAS 169189-80-4) is a chemical compound with the molecular formula C8H10BrNO2S and a molecular weight of 264.14 g/mol. IUPAC name: 2-bromo-N-ethylbenzenesulfonamide. InChIKey: PAMGXYQVJKXRMX-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO2S |
|---|---|
| Molecular weight | 264.14 g/mol |
| IUPAC name | 2-bromo-N-ethylbenzenesulfonamide |
| InChIKey | PAMGXYQVJKXRMX-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)C1=CC=CC=C1Br |
Computed by PubChem (NCBI)