CAS 1691930-69-4 is the registry number for 5-Chloro-pyrazine-2-carboxylic acid (2,2,2-trifluoro-ethyl)-amide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-chloro-N-(2,2,2-trifluoroethyl)pyrazine-2-carboxamide (CAS 1691930-69-4) is a chemical compound with the molecular formula C7H5ClF3N3O and a molecular weight of 239.58 g/mol. IUPAC name: 5-chloro-N-(2,2,2-trifluoroethyl)pyrazine-2-carboxamide. InChIKey: CSQNELZSGIHEMZ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3N3O |
|---|---|
| Molecular weight | 239.58 g/mol |
| IUPAC name | 5-chloro-N-(2,2,2-trifluoroethyl)pyrazine-2-carboxamide |
| InChIKey | CSQNELZSGIHEMZ-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=N1)Cl)C(=O)NCC(F)(F)F |
Computed by PubChem (NCBI)