CAS 78152-17-7 is the registry number for N'-(6-Chloropyridin-2-yl)-2,2,2-trifluoroacetohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N'-(6-chloro-2-pyridinyl)-2,2,2-trifluoroacetohydrazide (CAS 78152-17-7) is a chemical compound with the molecular formula C7H5ClF3N3O and a molecular weight of 239.58 g/mol. IUPAC name: N'-(6-chloro-2-pyridinyl)-2,2,2-trifluoroacetohydrazide. InChIKey: QRAYHZDCSNKYGQ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3N3O |
|---|---|
| Molecular weight | 239.58 g/mol |
| IUPAC name | N'-(6-chloro-2-pyridinyl)-2,2,2-trifluoroacetohydrazide |
| InChIKey | QRAYHZDCSNKYGQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Cl)NNC(=O)C(F)(F)F |
Computed by PubChem (NCBI)