CAS 303997-55-9 is the registry number for 3-Chloro-n'-hydroxy-5-(trifluoromethyl)-2-pyridinecarboximidamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-chloro-N'-hydroxy-5-(trifluoromethyl)pyridine-2-carboximidamide (CAS 303997-55-9) is a chemical compound with the molecular formula C7H5ClF3N3O and a molecular weight of 239.58 g/mol. IUPAC name: 3-chloro-N'-hydroxy-5-(trifluoromethyl)pyridine-2-carboximidamide. InChIKey: VSKGVOPVZKZMBT-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3N3O |
|---|---|
| Molecular weight | 239.58 g/mol |
| IUPAC name | 3-chloro-N'-hydroxy-5-(trifluoromethyl)pyridine-2-carboximidamide |
| InChIKey | VSKGVOPVZKZMBT-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)/C(=N/O)/N)C(F)(F)F |
Computed by PubChem (NCBI)