CAS 1691964-22-3 appears in our catalog under these names: 3'-Imino-3,4-dihydro-2H-spiro(naphthalene-1,2'-(1,4)oxazolidine)-5'-one, 95%, 3'-Imino-3,4-dihydro-2H-spiro(naphthalene-1,2'-(1,4)oxazolidine)-5'-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-aminospiro[1,3-oxazole-5,4'-2,3-dihydro-1H-naphthalene]-2-one (CAS 1691964-22-3) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 4-aminospiro[1,3-oxazole-5,4'-2,3-dihydro-1H-naphthalene]-2-one. InChIKey: REFIFZTZIBUIDV-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 4-aminospiro[1,3-oxazole-5,4'-2,3-dihydro-1H-naphthalene]-2-one |
| InChIKey | REFIFZTZIBUIDV-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2C3(C1)C(=NC(=O)O3)N |
Computed by PubChem (NCBI)