Products 169280-21-1

CAS 169280-21-1 is the registry number for Fexofenadine Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[4-(4-chlorobutanoyl)phenyl]-2-methylpropanoic acid (CAS 169280-21-1) is a chemical compound with the molecular formula C14H17ClO3 and a molecular weight of 268.73 g/mol. IUPAC name: 2-[4-(4-chlorobutanoyl)phenyl]-2-methylpropanoic acid. InChIKey: VBTJEFSCACXENO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17ClO3
Molecular weight268.73 g/mol
IUPAC name2-[4-(4-chlorobutanoyl)phenyl]-2-methylpropanoic acid
InChIKeyVBTJEFSCACXENO-UHFFFAOYSA-N
SMILESCC(C)(C1=CC=C(C=C1)C(=O)CCCCl)C(=O)O

Computed by PubChem (NCBI)