Products 69801-29-2

CAS 69801-29-2 is the registry number for Alclofenac Isopropyl Ester. Offered by: Mikromol. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Propan-2-yl 2-(3-chloro-4-prop-2-enoxyphenyl)acetate (CAS 69801-29-2) is a chemical compound with the molecular formula C14H17ClO3 and a molecular weight of 268.73 g/mol. IUPAC name: propan-2-yl 2-(3-chloro-4-prop-2-enoxyphenyl)acetate. InChIKey: UFLQDRBPLDZPHA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17ClO3
Molecular weight268.73 g/mol
IUPAC namepropan-2-yl 2-(3-chloro-4-prop-2-enoxyphenyl)acetate
InChIKeyUFLQDRBPLDZPHA-UHFFFAOYSA-N
SMILESCC(C)OC(=O)CC1=CC(=C(C=C1)OCC=C)Cl

Computed by PubChem (NCBI)