CAS 58345-04-3 appears in our catalog under these names: Stiripentol Impurity 11, Stiripentol Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-1-(6-chloro-1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-ol (CAS 58345-04-3) is a chemical compound with the molecular formula C14H17ClO3 and a molecular weight of 268.73 g/mol. IUPAC name: (E)-1-(6-chloro-1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-ol. InChIKey: QEOJXWCKXMKIBI-SNAWJCMRSA-N.
| Molecular formula | C14H17ClO3 |
|---|---|
| Molecular weight | 268.73 g/mol |
| IUPAC name | (E)-1-(6-chloro-1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-ol |
| InChIKey | QEOJXWCKXMKIBI-SNAWJCMRSA-N |
| SMILES | CC(C)(C)C(/C=C/C1=CC2=C(C=C1Cl)OCO2)O |
Computed by PubChem (NCBI)