Products 169397-99-3
CAS 169397-99-3 appears in our catalog under these names: 1,8-Octanedioic-d12 Acid, 98 atom % D, min 98% Chemical Purity, Suberic acid–d12, Suberic acid-d12, 98.60%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 10mg, 25mg, 5mg, 25 mg, 10 mg, 50 mg.
2,2,3,3,4,4,5,5,6,6,7,7-dodecadeuteriooctanedioic acid (CAS 169397-99-3) is a chemical compound with the molecular formula C8H14O4 and a molecular weight of 186.27 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7-dodecadeuteriooctanedioic acid. InChIKey: TYFQFVWCELRYAO-LBTWDOQPSA-N.
| Molecular formula | C8H14O4 |
|---|---|
| Molecular weight | 186.27 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecadeuteriooctanedioic acid |
| InChIKey | TYFQFVWCELRYAO-LBTWDOQPSA-N |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)