Products 19031-57-3
CAS 19031-57-3 appears in our catalog under these names: 1,8-Octanedioic-2,2,7,7-d4 Acid, 98 atom % D, min 98% Chemical Purity, Suberic Acid-d4, >95% (HPLC), Suberic acid–d4, Suberic acid-d4, 99.93%. Offered by: CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: 1g, 0,5g, 100mg, 25mg, 50mg, 10mg, 5mg, 50 mg.
2,2,7,7-tetradeuteriooctanedioic acid (CAS 19031-57-3) is a chemical compound with the molecular formula C8H14O4 and a molecular weight of 178.22 g/mol. IUPAC name: 2,2,7,7-tetradeuteriooctanedioic acid. InChIKey: TYFQFVWCELRYAO-NZLXMSDQSA-N.
| Molecular formula | C8H14O4 |
|---|---|
| Molecular weight | 178.22 g/mol |
| IUPAC name | 2,2,7,7-tetradeuteriooctanedioic acid |
| InChIKey | TYFQFVWCELRYAO-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(CCCCC([2H])([2H])C(=O)O)C(=O)O |
Computed by PubChem (NCBI)