Products 1694637-31-4
CAS 1694637-31-4 is the registry number for 4-Bromo-3-(oxetan-3-yloxy)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-bromo-3-(oxetan-3-yloxy)benzoic acid (CAS 1694637-31-4) is a chemical compound with the molecular formula C10H9BrO4 and a molecular weight of 273.08 g/mol. IUPAC name: 4-bromo-3-(oxetan-3-yloxy)benzoic acid. InChIKey: KDXNFZHFWFJKBF-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO4 |
|---|---|
| Molecular weight | 273.08 g/mol |
| IUPAC name | 4-bromo-3-(oxetan-3-yloxy)benzoic acid |
| InChIKey | KDXNFZHFWFJKBF-UHFFFAOYSA-N |
| SMILES | C1C(CO1)OC2=C(C=CC(=C2)C(=O)O)Br |
Computed by PubChem (NCBI)